EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O7.Cl |
| Net Charge | 0 |
| Average Mass | 352.726 |
| Monoisotopic Mass | 352.03498 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc(O)c1O.[Cl-] |
| InChI | InChI=1S/C16H12O7.ClH/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16;/h2-6H,1H3,(H4-,17,18,19,20,21);1H |
| InChIKey | QULMBDNPZCFSPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petunidin chloride (CHEBI:75035) has role metabolite (CHEBI:25212) |
| petunidin chloride (CHEBI:75035) is a anthocyanidin chloride (CHEBI:38696) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxychromenium chloride |
| Synonyms | Source |
|---|---|
| Petunidin | KEGG COMPOUND |
| 3,3',4',5,7-pentahydroxy-5'-methoxyflavylium chloride | HMDB |
| Petunidol | HMDB |
| Petunidol chloride | HMDB |
| 2-(3,4-Dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1-benzopyrylium chloride | ChemIDplus |
| Citations |
|---|