EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O3 |
| Net Charge | 0 |
| Average Mass | 246.266 |
| Monoisotopic Mass | 246.10044 |
| SMILES | O=C1CC[C@H](NC(=O)Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C13H14N2O3/c16-11-7-6-10(13(18)15-11)14-12(17)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,17)(H,15,16,18)/t10-/m0/s1 |
| InChIKey | OQGRFQCUGLKSAV-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antineoplaston a10 (CHEBI:750341) has role antineoplastic agent (CHEBI:35610) |
| antineoplaston a10 (CHEBI:750341) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| Antineoplaston a 10 | ChEMBL |
| Antineoplaston a10 | ChEMBL |
| Atengenal | ChEMBL |