EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H21FN6O2S |
| Net Charge | 0 |
| Average Mass | 488.548 |
| Monoisotopic Mass | 488.14307 |
| SMILES | Nc1ncc(-c2cnn(CCO)c2)c2scc(-c3ccc(NC(=O)Nc4cccc(F)c4)cc3)c12 |
| InChI | InChI=1S/C25H21FN6O2S/c26-17-2-1-3-19(10-17)31-25(34)30-18-6-4-15(5-7-18)21-14-35-23-20(12-28-24(27)22(21)23)16-11-29-32(13-16)8-9-33/h1-7,10-14,33H,8-9H2,(H2,27,28)(H2,30,31,34) |
| InChIKey | WPHKIQPVPYJNAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ilorasertib (CHEBI:750338) has role antineoplastic agent (CHEBI:35610) |
| ilorasertib (CHEBI:750338) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| ilorasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-968660 | ChEMBL |
| A-968660.0 | ChEMBL |
| ABBOTT-968660 | ChEMBL |
| ABT-348 | ChEMBL |
| Brand Name | Source |
|---|---|
| Abt-348, a-968660 | ChEMBL |
| Citations |
|---|