EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O3 |
| Net Charge | 0 |
| Average Mass | 240.258 |
| Monoisotopic Mass | 240.07864 |
| SMILES | Oc1ccc(C2=Cc3ccc(O)cc3OC2)cc1 |
| InChI | InChI=1S/C15H12O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-8,16-17H,9H2 |
| InChIKey | ZZUBHVMHNVYXRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idronoxil (CHEBI:750316) has role antineoplastic agent (CHEBI:35610) |
| idronoxil (CHEBI:750316) is a isoflavonoid (CHEBI:50753) |
| INNs | Source |
|---|---|
| idronoxil | WHO MedNet |
| idronoxilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dehydroequol | ChEMBL |
| NV-06 | ChEMBL |
| Phenoxodiol | ChEMBL |
| Brand Names | Source |
|---|---|
| Idronoxil component of nox-66 | ChEMBL |
| Idronoxil component of nox66 suppository | ChEMBL |
| Citations |
|---|