EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H56ClF2N6O8PS |
| Net Charge | 0 |
| Average Mass | 957.478 |
| Monoisotopic Mass | 956.32745 |
| SMILES | [H][C@]12CCCCCCC[C@H](NC(=O)OC3CCCC3)C(=O)N3C[C@H](Oc4cc(-c5csc(NC(C)C)n5)nc5c(Cl)c(OC)ccc45)C[C@@]3([H])C(=O)N[C@]1(P(=O)(O)Cc1c(F)cccc1F)C2 |
| InChI | InChI=1S/C46H56ClF2N6O8PS/c1-26(2)50-44-52-36(25-65-44)35-21-39(30-18-19-38(61-3)40(47)41(30)51-35)62-29-20-37-42(56)54-46(64(59,60)24-31-32(48)15-11-16-33(31)49)22-27(46)12-7-5-4-6-8-17-34(43(57)55(37)23-29)53-45(58)63-28-13-9-10-14-28/h11,15-16,18-19,21,25-29,34,37H,4-10,12-14,17,20,22-24H2,1-3H3,(H,50,52)(H,53,58)(H,54,56)(H,59,60)/t27-,29-,34+,37+,46+/m1/s1 |
| InChIKey | RFGUWOCFYCYEDM-ZOMNBDOOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gs-9256 (CHEBI:750315) has role antiviral agent (CHEBI:22587) |
| gs-9256 (CHEBI:750315) is a cyclic peptide (CHEBI:23449) |
| Synonym | Source |
|---|---|
| Gs-9256 | ChEMBL |
| Citations |
|---|