EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H43F2N3O5S2 |
| Net Charge | 0 |
| Average Mass | 639.831 |
| Monoisotopic Mass | 639.26122 |
| SMILES | CCN(C(=O)Cc1ccc(S(C)(=O)=O)cc1)C1CCN(CC[C@@H](c2cc(F)cc(F)c2)C2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C31H43F2N3O5S2/c1-4-36(31(37)19-23-5-7-29(8-6-23)42(2,38)39)28-11-14-34(15-12-28)16-13-30(25-20-26(32)22-27(33)21-25)24-9-17-35(18-10-24)43(3,40)41/h5-8,20-22,24,28,30H,4,9-19H2,1-3H3/t30-/m1/s1 |
| InChIKey | QOSMEMHKXNNIGG-SSEXGKCCSA-N |
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd5672 (CHEBI:750313) has role antirheumatic drug (CHEBI:35842) |
| azd5672 (CHEBI:750313) has role renoprotective agent (CHEBI:231911) |
| azd5672 (CHEBI:750313) is a acetamides (CHEBI:22160) |
| Synonyms | Source |
|---|---|
| Azd 5672 | ChEMBL |
| Azd-5672 | ChEMBL |
| AZD5672 | ChEMBL |
| Citations |
|---|