EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4 |
| Net Charge | 0 |
| Average Mass | 303.358 |
| Monoisotopic Mass | 303.14706 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(C)[C@]([H])(C4)[C@]3(O)CC[C@@H]2O |
| InChI | InChI=1S/C17H21NO4/c1-18-7-6-16-13-9-2-3-10(19)14(13)22-15(16)11(20)4-5-17(16,21)12(18)8-9/h2-3,11-12,15,19-21H,4-8H2,1H3/t11-,12+,15-,16-,17+/m0/s1 |
| InChIKey | AABLHGPVOULICI-BRJGLHKUSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydromorphinol (CHEBI:750312) is a phenanthrenes (CHEBI:25961) |
| INNs | Source |
|---|---|
| hidromorfinol | WHO MedNet |
| hydromorphinol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 14-hydroxy-7,8-dihydromorphine | ChEMBL |
| 14-hydroxydihydromorphine | ChEMBL |
| 6.alpha.-oxymorphol | ChEMBL |
| .alpha.-oxymorphol | ChEMBL |
| IDS-NH-003 | ChEMBL |
| Numorphan oral | ChEMBL |
| Citations |
|---|