EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N5O6S |
| Net Charge | 0 |
| Average Mass | 479.559 |
| Monoisotopic Mass | 479.18385 |
| SMILES | COc1c(Nc2ccc(S(C)(=O)=O)nc2C)ncnc1OC1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C21H29N5O6S/c1-13(2)31-21(27)26-10-8-15(9-11-26)32-20-18(30-4)19(22-12-23-20)25-16-6-7-17(24-14(16)3)33(5,28)29/h6-7,12-13,15H,8-11H2,1-5H3,(H,22,23,25) |
| InChIKey | WPDCHTSXOPUOII-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adp-597 (CHEBI:750309) has role hypoglycemic agent (CHEBI:35526) |
| adp-597 (CHEBI:750309) is a carboxylic acid (CHEBI:33575) |
| adp-597 (CHEBI:750309) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Adp-597 | ChEMBL |
| JNJ-38431055 | ChEMBL |
| Citations |
|---|