EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750306 - binodenoson
| Formula | C17H25N7O4 |
| Net Charge | 0 |
| Average Mass | 391.432 |
| Monoisotopic Mass | 391.19680 |
| SMILES | Nc1nc(N/N=C/C2CCCCC2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H25N7O4/c18-14-11-15(22-17(21-14)23-20-6-9-4-2-1-3-5-9)24(8-19-11)16-13(27)12(26)10(7-25)28-16/h6,8-10,12-13,16,25-27H,1-5,7H2,(H3,18,21,22,23)/b20-6+/t10-,12-,13-,16-/m1/s1 |
| InChIKey | XJFMHMFFBSOEPR-DNZQAUTHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| binodenoson (CHEBI:750306) is a purine nucleoside (CHEBI:26394) |
| Synonyms | Source |
|---|---|
| Binodenoson | ChEMBL |
| MRE-0470 | ChEMBL |
| MRE0470 | ChEMBL |
| Wrc0470 | ChEMBL |
| Brand Name | Source |
|---|---|
| Corvue | ChEMBL |
| Citations |
|---|