EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750303 - relmapirazin
| Formula | C12H16N6O8 |
| Net Charge | 0 |
| Average Mass | 372.294 |
| Monoisotopic Mass | 372.10296 |
| SMILES | Nc1nc(C(=O)N[C@H](CO)C(=O)O)c(N)nc1C(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C12H16N6O8/c13-7-5(9(21)15-3(1-19)11(23)24)17-8(14)6(18-7)10(22)16-4(2-20)12(25)26/h3-4,19-20H,1-2H2,(H2,14,17)(H2,13,18)(H,15,21)(H,16,22)(H,23,24)(H,25,26)/t3-,4-/m1/s1 |
| InChIKey | XHNJXRDGTITISI-QWWZWVQMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| relmapirazin (CHEBI:750303) has role antineoplastic agent (CHEBI:35610) |
| relmapirazin (CHEBI:750303) has role renoprotective agent (CHEBI:231911) |
| relmapirazin (CHEBI:750303) is a N-acyl-amino acid (CHEBI:51569) |
| INNs | Source |
|---|---|
| relmapirazin | WHO MedNet |
| relmapirazina | WHO MedNet |
| relmapirazine | WHO MedNet |
| Synonym | Source |
|---|---|
| MB-102 | ChEMBL |
| Brand Name | Source |
|---|---|
| Lumitrace | ChEMBL |
| Citations |
|---|