EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30N4O2S |
| Net Charge | 0 |
| Average Mass | 498.652 |
| Monoisotopic Mass | 498.20895 |
| SMILES | CN(CCO)C(=O)c1ccc(C(=C2CCN(Cc3cscn3)CC2)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C29H30N4O2S/c1-32(16-17-34)29(35)24-9-7-21(8-10-24)27(26-6-2-4-23-5-3-13-30-28(23)26)22-11-14-33(15-12-22)18-25-19-36-20-31-25/h2-10,13,19-20,34H,11-12,14-18H2,1H3 |
| InChIKey | ZJKUETLEJYCOBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-7268 (CHEBI:750302) has role antidepressant (CHEBI:35469) |
| azd-7268 (CHEBI:750302) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| AZ-12488024 | ChEMBL |
| AZ12488024 | ChEMBL |
| Azd 7268 | ChEMBL |
| Azd-7268 | ChEMBL |
| AZD7268 | ChEMBL |
| Citations |
|---|