EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H12Cl2N6O |
| Net Charge | 0 |
| Average Mass | 435.274 |
| Monoisotopic Mass | 434.04496 |
| SMILES | N#Cc1cc(Cl)cc(Oc2c(Cl)ccc3c2cnn3Cc2nnc3ncccc23)c1 |
| InChI | InChI=1S/C21H12Cl2N6O/c22-13-6-12(9-24)7-14(8-13)30-20-16-10-26-29(19(16)4-3-17(20)23)11-18-15-2-1-5-25-21(15)28-27-18/h1-8,10H,11H2,(H,25,27,28) |
| InChIKey | FZBAOOQVQXATRL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-6186 (CHEBI:750298) has role anti-HIV agent (CHEBI:64946) |
| mk-6186 (CHEBI:750298) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Mk-6186 | ChEMBL |
| MK6186 | ChEMBL |
| Citations |
|---|