EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N4O4 |
| Net Charge | 0 |
| Average Mass | 474.561 |
| Monoisotopic Mass | 474.22671 |
| SMILES | COc1ccc(C(=O)Nc2cccc(O)c2NC(=O)c2ccc(N3CCCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-30-15-4-16-31(18-17-30)21-11-7-19(8-12-21)27(34)29-25-23(5-3-6-24(25)32)28-26(33)20-9-13-22(35-2)14-10-20/h3,5-14,32H,4,15-18H2,1-2H3,(H,28,33)(H,29,34) |
| InChIKey | IJNIQYINMSGIPS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| darexaban (CHEBI:750289) has role anti-arrhythmia drug (CHEBI:38070) |
| darexaban (CHEBI:750289) has role cardiovascular drug (CHEBI:35554) |
| darexaban (CHEBI:750289) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| darexaban | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tanexaban | ChEMBL |
| YM-150 | ChEMBL |
| YM150 | ChEMBL |
| Citations |
|---|