EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N8O3S |
| Net Charge | 0 |
| Average Mass | 498.613 |
| Monoisotopic Mass | 498.21616 |
| SMILES | Cc1c(CN2CCN(C(=O)[C@H](C)O)CC2)sc2c(N3CCOCC3)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C23H30N8O3S/c1-14-17(13-29-3-5-31(6-4-29)22(33)15(2)32)35-19-18(14)27-20(16-11-25-23(24)26-12-16)28-21(19)30-7-9-34-10-8-30/h11-12,15,32H,3-10,13H2,1-2H3,(H2,24,25,26)/t15-/m0/s1 |
| InChIKey | YOVVNQKCSKSHKT-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apitolisib (CHEBI:750288) has role antineoplastic agent (CHEBI:35610) |
| apitolisib (CHEBI:750288) is a organic heterobicyclic compound (CHEBI:27171) |
| apitolisib (CHEBI:750288) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| apitolisib (CHEBI:750288) is a organosulfur heterocyclic compound (CHEBI:38106) |
| INN | Source |
|---|---|
| apitolisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| G-038390 | ChEMBL |
| G-038390.1 | ChEMBL |
| GDC-0980 | ChEMBL |
| GDC-0980.1 | ChEMBL |
| Gne-390 | ChEMBL |
| RG-7422 | ChEMBL |
| Citations |
|---|