EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27FN2O2 |
| Net Charge | 0 |
| Average Mass | 418.512 |
| Monoisotopic Mass | 418.20566 |
| SMILES | Cc1cc(C)cc([C@@H]2CCCN2Cc2ccc(Oc3ccc(C(N)=O)cc3F)cc2)c1 |
| InChI | InChI=1S/C26H27FN2O2/c1-17-12-18(2)14-21(13-17)24-4-3-11-29(24)16-19-5-8-22(9-6-19)31-25-10-7-20(26(28)30)15-23(25)27/h5-10,12-15,24H,3-4,11,16H2,1-2H3,(H2,28,30)/t24-/m0/s1 |
| InChIKey | ZHPMYDSXGRRERG-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aticaprant (CHEBI:750286) has role antidepressant (CHEBI:35469) |
| aticaprant (CHEBI:750286) has role anxiolytic drug (CHEBI:35474) |
| aticaprant (CHEBI:750286) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| aticaprant | WHO MedNet |
| Synonyms | Source |
|---|---|
| CERC-501 | ChEMBL |
| Jnj-67953964 | ChEMBL |
| JNJ-67953964-AAA | ChEMBL |
| JSPA-0658 | ChEMBL |
| JSPA0658 | ChEMBL |
| LY-2456302 | ChEMBL |
| Citations |
|---|