EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N6 |
| Net Charge | 0 |
| Average Mass | 262.361 |
| Monoisotopic Mass | 262.19059 |
| SMILES | CN[C@@H]1CCN(c2cc(NCC3CC3)nc(N)n2)C1 |
| InChI | InChI=1S/C13H22N6/c1-15-10-4-5-19(8-10)12-6-11(17-13(14)18-12)16-7-9-2-3-9/h6,9-10,15H,2-5,7-8H2,1H3,(H3,14,16,17,18)/t10-/m1/s1 |
| InChIKey | ISBHYKVAFKTATD-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antipsoriatic A drug used to treat psoriasis. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adriforant (CHEBI:750284) has role anti-asthmatic agent (CHEBI:65023) |
| adriforant (CHEBI:750284) has role antipsoriatic (CHEBI:50748) |
| adriforant (CHEBI:750284) has role dermatologic drug (CHEBI:50177) |
| adriforant (CHEBI:750284) is a dialkylarylamine (CHEBI:23665) |
| adriforant (CHEBI:750284) is a tertiary amino compound (CHEBI:50996) |
| INN | Source |
|---|---|
| adriforant | WHO MedNet |
| Synonyms | Source |
|---|---|
| NVP-ZPL389-NX | ChEMBL |
| PF-03893787 | ChEMBL |
| PF-3893787 | ChEMBL |
| ZPL-389 | ChEMBL |
| ZPL-3893787 | ChEMBL |
| ZPL-389-NX | ChEMBL |
| Citations |
|---|