EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N7O7 |
| Net Charge | 0 |
| Average Mass | 473.446 |
| Monoisotopic Mass | 473.16590 |
| SMILES | Nc1nc2c(c(=O)n1)N(C=O)[C@@H](CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32)/t12-,13-/m0/s1 |
| InChIKey | VVIAGPKUTFNRDU-STQMWFEESA-N |
| Roles Classification |
|---|
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levoleucovorin (CHEBI:750266) has role anti-anaemic agent (CHEBI:75835) |
| levoleucovorin (CHEBI:750266) has role antineoplastic agent (CHEBI:35610) |
| levoleucovorin (CHEBI:750266) is a glutamic acid derivative (CHEBI:24315) |
| Synonym | Source |
|---|---|
| LFP-754 | ChEMBL |
| Brand Name | Source |
|---|---|
| Khapzory | ChEMBL |