EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750262 - cefcanel
| Formula | C19H18N4O5S3 |
| Net Charge | 0 |
| Average Mass | 478.577 |
| Monoisotopic Mass | 478.04393 |
| SMILES | [H][C@]12SCC(CSc3nnc(C)s3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O5S3/c1-9-21-22-19(31-9)30-8-11-7-29-17-12(16(26)23(17)13(11)18(27)28)20-15(25)14(24)10-5-3-2-4-6-10/h2-6,12,14,17,24H,7-8H2,1H3,(H,20,25)(H,27,28)/t12-,14-,17-/m1/s1 |
| InChIKey | VDFFPBOAOLQAJV-SUYBPPKGSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefcanel (CHEBI:750262) is a cephalosporin (CHEBI:23066) |
| INN | Source |
|---|---|
| cefcanel | WHO MedNet |
| Citations |
|---|