EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750244 - dexfenfluramine hydrochloride
| Formula | HCl.C12H16F3N |
| Net Charge | 0 |
| Average Mass | 267.722 |
| Monoisotopic Mass | 267.10016 |
| SMILES | CCN[C@@H](C)Cc1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H16F3N.ClH/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15;/h4-6,8-9,16H,3,7H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | ZXKXJHAOUFHNAS-FVGYRXGTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexfenfluramine hydrochloride (CHEBI:750244) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| Adipomin | ChEMBL |
| D-fenfluramine hydrochloride | ChEMBL |
| Fenfluramine d-form hydrochloride | ChEMBL |
| Glypolix | ChEMBL |
| Isomeride | ChEMBL |
| S 5614 HCL | ChEMBL |
| Brand Name | Source |
|---|---|
| Adifax | ChEMBL |