EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750240 - lifibrate
| Formula | C20H21Cl2NO4 |
| Net Charge | 0 |
| Average Mass | 410.297 |
| Monoisotopic Mass | 409.08476 |
| SMILES | CN1CCC(OC(=O)C(Oc2ccc(Cl)cc2)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H21Cl2NO4/c1-23-12-10-18(11-13-23)25-19(24)20(26-16-6-2-14(21)3-7-16)27-17-8-4-15(22)5-9-17/h2-9,18,20H,10-13H2,1H3 |
| InChIKey | QDGIAPPCJRFVEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lifibrate (CHEBI:750240) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| lifibrate | WHO MedNet |
| lifibrato | WHO MedNet |
| Synonym | Source |
|---|---|
| 42-348 | ChEMBL |
| Citations |
|---|