EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | C[C@]12CC[C@H](O)CC1=CC(=O)C1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C19H26O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-14,17,20H,3-9H2,1-2H3/t12-,13?,14?,17?,18-,19-/m0/s1 |
| InChIKey | KPRGOTLNGIBVFL-VYLIMTTQSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-keto-dehydroepiandrosterone (CHEBI:750232) has role androgen (CHEBI:50113) |
| 7-keto-dehydroepiandrosterone (CHEBI:750232) has role antidepressant (CHEBI:35469) |
| 7-keto-dehydroepiandrosterone (CHEBI:750232) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 7-keto dehydroepiandrosterone | ChEMBL |