EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750220 - pf-04620110
| Formula | C21H24N4O4 |
| Net Charge | 0 |
| Average Mass | 396.447 |
| Monoisotopic Mass | 396.17976 |
| SMILES | Nc1ncnc2c1C(=O)N(c1ccc([C@H]3CC[C@H](CC(=O)O)CC3)cc1)CCO2 |
| InChI | InChI=1S/C21H24N4O4/c22-19-18-20(24-12-23-19)29-10-9-25(21(18)28)16-7-5-15(6-8-16)14-3-1-13(2-4-14)11-17(26)27/h5-8,12-14H,1-4,9-11H2,(H,26,27)(H2,22,23,24)/t13-,14- |
| InChIKey | GEVVQZHMFVFGLN-HDJSIYSDSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-04620110 (CHEBI:750220) has role anti-obesity agent (CHEBI:74518) |
| pf-04620110 (CHEBI:750220) has role hypoglycemic agent (CHEBI:35526) |
| pf-04620110 (CHEBI:750220) is a gitoxigenin (CHEBI:38105) |
| pf-04620110 (CHEBI:750220) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Synonyms | Source |
|---|---|
| Pf-04620110 | ChEMBL |
| PF-4620110 | ChEMBL |
| Citations |
|---|