EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O3S |
| Net Charge | 0 |
| Average Mass | 356.447 |
| Monoisotopic Mass | 356.11946 |
| SMILES | CCOc1ccc(-c2cc(C)cn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-3-24-17-8-4-15(5-9-17)19-12-14(2)13-21(19)16-6-10-18(11-7-16)25(20,22)23/h4-13H,3H2,1-2H3,(H2,20,22,23) |
| InChIKey | JTMITOKKUMVWRT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apricoxib (CHEBI:750219) has role antineoplastic agent (CHEBI:35610) |
| apricoxib (CHEBI:750219) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| apricoxib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CS-706 | ChEMBL |
| R-109339 | ChEMBL |
| TG-01 | ChEMBL |
| TG01 | ChEMBL |
| Citations |
|---|