EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O4P.C26H31Cl2N7O3 |
| Net Charge | 0 |
| Average Mass | 658.480 |
| Monoisotopic Mass | 657.16344 |
| SMILES | CCN1CCN(c2ccc(Nc3cc(N(C)C(=O)Nc4c(Cl)c(OC)cc(OC)c4Cl)ncn3)cc2)CC1.O=P(O)(O)O |
| InChI | InChI=1S/C26H31Cl2N7O3.H3O4P/c1-5-34-10-12-35(13-11-34)18-8-6-17(7-9-18)31-21-15-22(30-16-29-21)33(2)26(36)32-25-23(27)19(37-3)14-20(38-4)24(25)28;1-5(2,3)4/h6-9,14-16H,5,10-13H2,1-4H3,(H,32,36)(H,29,30,31);(H3,1,2,3,4) |
| InChIKey | GUQNHCGYHLSITB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| infigratinib phosphate (CHEBI:750218) has role antineoplastic agent (CHEBI:35610) |
| infigratinib phosphate (CHEBI:750218) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| BGJ-398 phosphate | ChEMBL |
| Infigratinib monophosphate | ChEMBL |
| Infigratinib phosphate | ChEMBL |
| Brand Name | Source |
|---|---|
| Truseltiq | ChEMBL |
| Citations |
|---|