EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33N5O2S |
| Net Charge | 0 |
| Average Mass | 503.672 |
| Monoisotopic Mass | 503.23550 |
| SMILES | Cc1ccc(C(=O)N(CCCN)C(c2nc3snc(C)c3c(=O)n2Cc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C28H33N5O2S/c1-18(2)24(32(16-8-15-29)27(34)22-13-11-19(3)12-14-22)25-30-26-23(20(4)31-36-26)28(35)33(25)17-21-9-6-5-7-10-21/h5-7,9-14,18,24H,8,15-17,29H2,1-4H3 |
| InChIKey | SMFXSYMLJDHGIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-4877 (CHEBI:750217) has role antineoplastic agent (CHEBI:35610) |
| azd-4877 (CHEBI:750217) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Azd 4877 | ChEMBL |
| Azd-4877 | ChEMBL |
| AZD4877 | ChEMBL |
| Citations |
|---|