EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750216 - artefenomel
| Formula | C28H39NO5 |
| Net Charge | 0 |
| Average Mass | 469.622 |
| Monoisotopic Mass | 469.28282 |
| SMILES | c1cc([C@H]2CC[C@]3(CC2)OO[C@]2(O3)C3CC4CC(C3)CC2C4)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C28H39NO5/c1-3-26(31-14-11-29-9-12-30-13-10-29)4-2-22(1)23-5-7-27(8-6-23)32-28(34-33-27)24-16-20-15-21(18-24)19-25(28)17-20/h1-4,20-21,23-25H,5-19H2/t20?,21?,23-,24?,25?,27+,28- |
| InChIKey | XLCNVWUKICLURR-NTNLSYPKSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artefenomel (CHEBI:750216) has role antimalarial (CHEBI:38068) |
| artefenomel (CHEBI:750216) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| artefenomel | WHO MedNet |
| Synonyms | Source |
|---|---|
| OZ-439 | ChEMBL |
| OZ439 | ChEMBL |
| Citations |
|---|