EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750210 - btz-043
| Formula | C17H16F3N3O5S |
| Net Charge | 0 |
| Average Mass | 431.392 |
| Monoisotopic Mass | 431.07628 |
| SMILES | C[C@H]1COC2(CCN(c3nc(=O)c4cc(C(F)(F)F)cc([N+](=O)[O-])c4s3)CC2)O1 |
| InChI | InChI=1S/C17H16F3N3O5S/c1-9-8-27-16(28-9)2-4-22(5-3-16)15-21-14(24)11-6-10(17(18,19)20)7-12(23(25)26)13(11)29-15/h6-7,9H,2-5,8H2,1H3/t9-/m0/s1 |
| InChIKey | GTUIRORNXIOHQR-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| btz-043 (CHEBI:750210) has role antitubercular agent (CHEBI:33231) |
| btz-043 (CHEBI:750210) is a benzothiazine (CHEBI:46899) |
| Synonyms | Source |
|---|---|
| Btz-043 | ChEMBL |
| BTZ-10526043 | ChEMBL |
| Bzt043 | ChEMBL |
| Citations |
|---|