EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C8H16N2O4/c1-4(2)6(9)7(12)10-5(3-11)8(13)14/h4-6,11H,3,9H2,1-2H3,(H,10,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | STTYIMSDIYISRG-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Val-Ser (CHEBI:75021) has role metabolite (CHEBI:25212) |
| Val-Ser (CHEBI:75021) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-valyl-L-serine |
| Synonyms | Source |
|---|---|
| VS | ChEBI |
| L-Val-L-Ser | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2723820 | Reaxys |
| CAS:13588-94-8 | ChemIDplus |