EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O2S |
| Net Charge | 0 |
| Average Mass | 372.534 |
| Monoisotopic Mass | 372.18715 |
| SMILES | CC(C)CNCc1ccc(-c2ccccc2S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H28N2O2S/c1-17(2)15-22-16-18-9-11-19(12-10-18)20-7-3-4-8-21(20)26(24,25)23-13-5-6-14-23/h3-4,7-12,17,22H,5-6,13-16H2,1-2H3 |
| InChIKey | OWVIKBRKPCTDEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-04455242 (CHEBI:750207) has role antidepressant (CHEBI:35469) |
| pf-04455242 (CHEBI:750207) has role antipsychotic agent (CHEBI:35476) |
| pf-04455242 (CHEBI:750207) is a sulfonamide (CHEBI:35358) |
| Synonym | Source |
|---|---|
| Pf-04455242 | ChEMBL |
| Citations |
|---|