EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O3 |
| Net Charge | 0 |
| Average Mass | 440.668 |
| Monoisotopic Mass | 440.32905 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@](C)(O)CCC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C29H44O3/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8,32)19-17-26-25(7)27(30)23(5)24(6)28(26)31/h12,14,16,32H,9-11,13,15,17-19H2,1-8H3/b21-14+,22-16+/t29-/m1/s1 |
| InChIKey | LNOVHERIIMJMDG-XZXLULOTSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vatiquinone (CHEBI:750204) has role antiparkinson drug (CHEBI:48407) |
| vatiquinone (CHEBI:750204) is a diterpenoid (CHEBI:23849) |
| INNs | Source |
|---|---|
| vatiquinona | WHO MedNet |
| vatiquinone | WHO MedNet |
| Synonyms | Source |
|---|---|
| .alpha.-tocotrienol quinone | ChEMBL |
| Alpha tocotrienol quinone | ChEMBL |
| Alpha-tocotrienol quinone | ChEMBL |
| EPI-743 | ChEMBL |
| PTC-743 | ChEMBL |
| PTC743 | ChEMBL |
| Citations |
|---|