EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19FN6O2 |
| Net Charge | 0 |
| Average Mass | 394.410 |
| Monoisotopic Mass | 394.15535 |
| SMILES | [H][C@@]12CN(c3ncc(C(=O)NO)cn3)C[C@]1([H])[C@H]2NCc1ccc2cc(F)ccc2n1 |
| InChI | InChI=1S/C20H19FN6O2/c21-13-2-4-17-11(5-13)1-3-14(25-17)8-22-18-15-9-27(10-16(15)18)20-23-6-12(7-24-20)19(28)26-29/h1-7,15-16,18,22,29H,8-10H2,(H,26,28)/t15-,16+,18+ |
| InChIKey | QRGHOAATPOLDPF-VQFNDLOPSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nanatinostat (CHEBI:750200) has role anti-inflammatory agent (CHEBI:67079) |
| nanatinostat (CHEBI:750200) has role antineoplastic agent (CHEBI:35610) |
| nanatinostat (CHEBI:750200) is a organohalogen compound (CHEBI:17792) |
| nanatinostat (CHEBI:750200) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| nanatinostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chr 3996 | ChEMBL |
| CHR-3996 | ChEMBL |
| Hdac inhibitor chr-3996 | ChEMBL |
| VRX-3996 | ChEMBL |
| Citations |
|---|