EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O15 |
| Net Charge | 0 |
| Average Mass | 596.538 |
| Monoisotopic Mass | 596.17412 |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](Oc3cc(O)c4c(c3)O[C@H](c3ccc(O)c(O)c3)CC4=O)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32O15/c1-9-20(33)22(35)24(37)26(38-9)42-25-23(36)21(34)18(8-28)41-27(25)39-11-5-14(31)19-15(32)7-16(40-17(19)6-11)10-2-3-12(29)13(30)4-10/h2-6,9,16,18,20-31,33-37H,7-8H2,1H3/t9-,16-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | OBKKEZLIABHSGY-DOYQYKRZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clinopodium chinense (ncbitaxon:516070) | aerial part (BTO:0001658) | PubMed (23178306) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neoeriocitrin (CHEBI:7502) has functional parent eriodictyol (CHEBI:28412) |
| neoeriocitrin (CHEBI:7502) has role plant metabolite (CHEBI:76924) |
| neoeriocitrin (CHEBI:7502) is a 4'-hydroxyflavanones (CHEBI:140331) |
| neoeriocitrin (CHEBI:7502) is a disaccharide derivative (CHEBI:63353) |
| neoeriocitrin (CHEBI:7502) is a flavanone glycoside (CHEBI:72730) |
| neoeriocitrin (CHEBI:7502) is a neohesperidoside (CHEBI:25495) |
| neoeriocitrin (CHEBI:7502) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-3,4-dihydro-2H-1-benzopyran-7-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Eriodictyol 7-O-neohesperidoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000986 | KNApSAcK |
| C09805 | KEGG COMPOUND |
| LMPK12140359 | LIPID MAPS |
| Neoeriocitrin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1304378 | Reaxys |
| CAS:13241-32-2 | ChemIDplus |
| CAS:13241-32-2 | KEGG COMPOUND |
| Citations |
|---|