EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H25F10NO3 |
| Net Charge | 0 |
| Average Mass | 637.514 |
| Monoisotopic Mass | 637.16748 |
| SMILES | COc1cc(F)c(C(C)C)cc1-c1ccc(C(F)(F)F)cc1CN1C(=O)O[C@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@@H]1C |
| InChI | InChI=1S/C30H25F10NO3/c1-14(2)22-11-23(25(43-4)12-24(22)31)21-6-5-18(28(32,33)34)9-17(21)13-41-15(3)26(44-27(41)42)16-7-19(29(35,36)37)10-20(8-16)30(38,39)40/h5-12,14-15,26H,13H2,1-4H3/t15-,26-/m0/s1 |
| InChIKey | MZZLGJHLQGUVPN-HAWMADMCSA-N |
| Roles Classification |
|---|
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anacetrapib (CHEBI:750199) has role antiatherosclerotic agent (CHEBI:145947) |
| anacetrapib (CHEBI:750199) has role anticholesteremic drug (CHEBI:35821) |
| anacetrapib (CHEBI:750199) has role cardiovascular drug (CHEBI:35554) |
| anacetrapib (CHEBI:750199) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| anacetrapib | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-0859 | ChEMBL |
| MK0859 | ChEMBL |
| Citations |
|---|