EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N4O3 |
| Net Charge | 0 |
| Average Mass | 366.421 |
| Monoisotopic Mass | 366.16919 |
| SMILES | CCCNC(=O)c1nnc2c(-c3cc(OC)ccc3OC)cccc2c1N |
| InChI | InChI=1S/C20H22N4O3/c1-4-10-22-20(25)19-17(21)14-7-5-6-13(18(14)23-24-19)15-11-12(26-2)8-9-16(15)27-3/h5-9,11H,4,10H2,1-3H3,(H2,21,23)(H,22,25) |
| InChIKey | NVWCZRPXYVDQEE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd6280 (CHEBI:750184) has role anxiolytic drug (CHEBI:35474) |
| azd6280 (CHEBI:750184) is a cinnolines (CHEBI:38770) |
| Synonyms | Source |
|---|---|
| Azd-6280 | ChEMBL |
| AZD6280 | ChEMBL |
| Citations |
|---|