EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26F3N3O3 |
| Net Charge | 0 |
| Average Mass | 401.429 |
| Monoisotopic Mass | 401.19263 |
| SMILES | CC(C)(C)OC[C@@H]1C(=O)NCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H26F3N3O3/c1-19(2,3)28-10-16-18(27)24-4-5-25(16)17(26)8-12(23)6-11-7-14(21)15(22)9-13(11)20/h7,9,12,16H,4-6,8,10,23H2,1-3H3,(H,24,27)/t12-,16-/m1/s1 |
| InChIKey | LCDDAGSJHKEABN-MLGOLLRUSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evogliptin (CHEBI:750182) has functional parent β-amino acid (CHEBI:33706) |
| evogliptin (CHEBI:750182) has role cardiovascular drug (CHEBI:35554) |
| evogliptin (CHEBI:750182) has role hypoglycemic agent (CHEBI:35526) |
| evogliptin (CHEBI:750182) has role renoprotective agent (CHEBI:231911) |
| evogliptin (CHEBI:750182) is a organonitrogen compound (CHEBI:35352) |
| evogliptin (CHEBI:750182) is a organooxygen compound (CHEBI:36963) |
| INNs | Source |
|---|---|
| evogliptina | WHO MedNet |
| evogliptine | WHO MedNet |
| Synonyms | Source |
|---|---|
| DA-1229 | ChEMBL |
| DA1229 | ChEMBL |
| Evogliptin | ChEMBL |
| Citations |
|---|