EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750174 - aminobenzoate sodium
| Formula | Na.C7H6NO2 |
| Net Charge | 0 |
| Average Mass | 159.120 |
| Monoisotopic Mass | 159.02962 |
| SMILES | Nc1ccc(C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C7H7NO2.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1 |
| InChIKey | XETSAYZRDCRPJY-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminobenzoate sodium (CHEBI:750174) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| Aminobenzoate sodium | ChEMBL |
| Sodium aminobenzoate | ChEMBL |
| Citations |
|---|