EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N2O4Si |
| Net Charge | 0 |
| Average Mass | 448.595 |
| Monoisotopic Mass | 448.18183 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(CC[Si](C)(C)C)cccc3nc2-1 |
| InChI | InChI=1S/C25H28N2O4Si/c1-5-25(30)19-12-21-22-16(13-27(21)23(28)18(19)14-31-24(25)29)11-17-15(9-10-32(2,3)4)7-6-8-20(17)26-22/h6-8,11-12,30H,5,9-10,13-14H2,1-4H3/t25-/m0/s1 |
| InChIKey | SYXGVIWFCCQOEK-VWLOTQADSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| karenitecin (CHEBI:750168) has role antineoplastic agent (CHEBI:35610) |
| karenitecin (CHEBI:750168) is a pyranoindolizinoquinoline (CHEBI:48626) |