EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5 |
| Net Charge | 0 |
| Average Mass | 232.236 |
| Monoisotopic Mass | 232.10592 |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c1-4(2)7(10)8(14)11-5(9(15)16)3-6(12)13/h4-5,7H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/t5-,7-/m0/s1 |
| InChIKey | OBTCMSPFOITUIJ-FSPLSTOPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Val-Asp (CHEBI:75009) has role metabolite (CHEBI:25212) |
| Val-Asp (CHEBI:75009) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-valyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-Val-L-Asp | ChEBI |
| Valyl-Aspartate | HMDB |
| valylaspartic acid | ChEBI |
| VD | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029123 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6892820 | Reaxys |