EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O4 |
| Net Charge | 0 |
| Average Mass | 309.366 |
| Monoisotopic Mass | 309.16886 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C15H23N3O4/c16-8-2-1-3-13(15(21)22)18-14(20)12(17)9-10-4-6-11(19)7-5-10/h4-7,12-13,19H,1-3,8-9,16-17H2,(H,18,20)(H,21,22)/t12-,13-/m0/s1 |
| InChIKey | AOLHUMAVONBBEZ-STQMWFEESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Lys (CHEBI:75004) has role metabolite (CHEBI:25212) |
| Tyr-Lys (CHEBI:75004) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tyrosyl-L-lysine |
| Synonyms | Source |
|---|---|
| L-Tyr-L-Lys | ChEBI |
| tyrosyllysine | ChEBI |
| Tyrosyl-Lysine | HMDB |
| YK | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029110 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3563389 | Reaxys |