EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750038 - ramixotidine
| Formula | C16H21N3O3S |
| Net Charge | 0 |
| Average Mass | 335.429 |
| Monoisotopic Mass | 335.13036 |
| SMILES | CN(C)Cc1ccc(CSCCNC(=O)c2ccc[n+]([O-])c2)o1 |
| InChI | InChI=1S/C16H21N3O3S/c1-18(2)11-14-5-6-15(22-14)12-23-9-7-17-16(20)13-4-3-8-19(21)10-13/h3-6,8,10H,7,9,11-12H2,1-2H3,(H,17,20) |
| InChIKey | HIVRCMFJEMKPDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ramixotidine (CHEBI:750038) is a aromatic carboxylic acid (CHEBI:33859) |
| ramixotidine (CHEBI:750038) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INNs | Source |
|---|---|
| ramixotidina | WHO MedNet |
| ramixotidine | WHO MedNet |