EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13ClN2O4 |
| Net Charge | 0 |
| Average Mass | 344.754 |
| Monoisotopic Mass | 344.05638 |
| SMILES | [H][C@](C)(Oc1ccc(Oc2cnc3ccc(Cl)cc3n2)cc1)C(=O)O |
| InChI | InChI=1S/C17H13ClN2O4/c1-10(17(21)22)23-12-3-5-13(6-4-12)24-16-9-19-14-7-2-11(18)8-15(14)20-16/h2-10H,1H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | NUQZXROIVGBRGR-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| r(+)xk469 (CHEBI:750003) has role antineoplastic agent (CHEBI:35610) |
| r(+)xk469 (CHEBI:750003) is a aromatic ether (CHEBI:35618) |
| r(+)xk469 (CHEBI:750003) is a carboxylic acid (CHEBI:33575) |
| Synonym | Source |
|---|---|
| R(+)xk469 | ChEMBL |
| Citations |
|---|