EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N2O |
| Net Charge | +1 |
| Average Mass | 227.287 |
| Monoisotopic Mass | 227.11789 |
| SMILES | C[n+]1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14N2O/c1-16-9-7-13(8-10-16)14(17)15-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3/p+1 |
| InChIKey | QOEJDHLJOKRPJG-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enisamium (CHEBI:750001) is a aromatic carboxylic acid (CHEBI:33859) |
| enisamium (CHEBI:750001) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| Enisamium cation | ChEMBL |
| Enisamium ion | ChEMBL |