EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O15 |
| Net Charge | 0 |
| Average Mass | 580.495 |
| Monoisotopic Mass | 580.14282 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2c([C@H]3OC[C@H](O)[C@H](O)[C@H]3O)c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C26H28O15/c27-5-13-18(33)21(36)23(38)26(41-13)15-19(34)14-10(30)4-12(7-1-2-8(28)9(29)3-7)40-24(14)16(20(15)35)25-22(37)17(32)11(31)6-39-25/h1-4,11,13,17-18,21-23,25-29,31-38H,5-6H2/t11-,13+,17-,18+,21-,22+,23+,25+,26-/m0/s1 |
| InChIKey | XBGYTZHKGMCEGE-LQYCTPBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (24310066) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neocarlinoside (CHEBI:7500) has functional parent flavone (CHEBI:42491) |
| neocarlinoside (CHEBI:7500) has role plant metabolite (CHEBI:76924) |
| neocarlinoside (CHEBI:7500) is a flavone C-glycoside (CHEBI:83280) |
| neocarlinoside (CHEBI:7500) is a tetrahydroxyflavone (CHEBI:38684) |
| Manual Xrefs | Databases |
|---|---|
| C00006188 | KNApSAcK |
| C10109 | KEGG COMPOUND |
| HMDB0037408 | HMDB |
| LMPK12110490 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6563442 | Reaxys |
| CAS:83151-89-7 | KEGG COMPOUND |
| Citations |
|---|