EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14F3N3O3 |
| Net Charge | 0 |
| Average Mass | 389.333 |
| Monoisotopic Mass | 389.09873 |
| SMILES | C[C@](O)(COc1ccc(C#N)cc1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3N3O3/c1-18(27,11-28-15-6-2-12(9-23)3-7-15)17(26)25-14-5-4-13(10-24)16(8-14)19(20,21)22/h2-8,27H,11H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | JNGVJMBLXIUVRD-SFHVURJKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enobosarm (CHEBI:749997) has role antineoplastic agent (CHEBI:35610) |
| enobosarm (CHEBI:749997) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| enobosarm | WHO MedNet |
| Synonyms | Source |
|---|---|
| GTX-024 | ChEMBL |
| MK-2866 | ChEMBL |
| Brand Name | Source |
|---|---|
| Ostarine | ChEMBL |
| Citations |
|---|