EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27N3O5 |
| Net Charge | 0 |
| Average Mass | 461.518 |
| Monoisotopic Mass | 461.19507 |
| SMILES | CNC(=O)c1c(C)oc2cc(Oc3ccnc4cc(OCCN5CCOCC5)ccc34)ccc12 |
| InChI | InChI=1S/C26H27N3O5/c1-17-25(26(30)27-2)21-6-4-19(16-24(21)33-17)34-23-7-8-28-22-15-18(3-5-20(22)23)32-14-11-29-9-12-31-13-10-29/h3-8,15-16H,9-14H2,1-2H3,(H,27,30) |
| InChIKey | LGXVKMDGSIWEHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-00337210 (CHEBI:749994) has role antineoplastic agent (CHEBI:35610) |
| pf-00337210 (CHEBI:749994) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Pf-00337210 | ChEMBL |
| Pf-337210 | ChEMBL |