EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27FN4O4 |
| Net Charge | 0 |
| Average Mass | 442.491 |
| Monoisotopic Mass | 442.20163 |
| SMILES | Cc1nc(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)NC[C@H](O)CN1CCOCC1 |
| InChI | InChI=1S/C23H27FN4O4/c1-13-20(10-18-17-9-15(24)3-4-19(17)27-22(18)30)26-14(2)21(13)23(31)25-11-16(29)12-28-5-7-32-8-6-28/h3-4,9-10,16,26,29H,5-8,11-12H2,1-2H3,(H,25,31)(H,27,30)/b18-10-/t16-/m0/s1 |
| InChIKey | CTNPALGJUAXMMC-PMFHANACSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| su-014813 (CHEBI:749989) has role antineoplastic agent (CHEBI:35610) |
| su-014813 (CHEBI:749989) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Su-014813 | ChEMBL |
| Su-14813 | ChEMBL |
| Citations |
|---|