EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N2O.I |
| Net Charge | 0 |
| Average Mass | 354.191 |
| Monoisotopic Mass | 354.02291 |
| SMILES | C[n+]1ccc(C(=O)NCc2ccccc2)cc1.[I-] |
| InChI | InChI=1S/C14H14N2O.HI/c1-16-9-7-13(8-10-16)14(17)15-11-12-5-3-2-4-6-12;/h2-10H,11H2,1H3;1H |
| InChIKey | ILSOAHPXYZRFBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enisamium iodide (CHEBI:749985) has role antiviral agent (CHEBI:22587) |
| enisamium iodide (CHEBI:749985) is a aromatic carboxylic acid (CHEBI:33859) |
| enisamium iodide (CHEBI:749985) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| Carbabenzpyride | ChEMBL |
| Enisamium iodide | ChEMBL |