EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749968 - isaxonine phosphate
| Formula | H3O4P.C7H11N3 |
| Net Charge | 0 |
| Average Mass | 235.180 |
| Monoisotopic Mass | 235.07219 |
| SMILES | CC(C)Nc1ncccn1.O=P(O)(O)O |
| InChI | InChI=1S/C7H11N3.H3O4P/c1-6(2)10-7-8-4-3-5-9-7;1-5(2,3)4/h3-6H,1-2H3,(H,8,9,10);(H3,1,2,3,4) |
| InChIKey | CXEBHWXMQKIKPJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isaxonine phosphate (CHEBI:749968) is a secondary amine (CHEBI:32863) |
| Synonyms | Source |
|---|---|
| Isaxonine phosphate | ChEMBL |
| Nerfactor | ChEMBL |
| Citations |
|---|