EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40F3N5O2 |
| Net Charge | 0 |
| Average Mass | 559.677 |
| Monoisotopic Mass | 559.31341 |
| SMILES | CCO[C@@H]1Cc2cc(C(F)(F)F)ccc2[C@H]1N1CCN(C2(C)CCN(C(=O)c3c(C)ncnc3C)CC2)C[C@@H]1C |
| InChI | InChI=1S/C30H40F3N5O2/c1-6-40-25-16-22-15-23(30(31,32)33)7-8-24(22)27(25)38-14-13-37(17-19(38)2)29(5)9-11-36(12-10-29)28(39)26-20(3)34-18-35-21(26)4/h7-8,15,18-19,25,27H,6,9-14,16-17H2,1-5H3/t19-,25+,27+/m0/s1 |
| InChIKey | ZMCJFJZOSKEMOM-DNKZPPIMSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| incb-9471 (CHEBI:749965) has role anti-HIV agent (CHEBI:64946) |
| incb-9471 (CHEBI:749965) is a indanes (CHEBI:46940) |
| Synonyms | Source |
|---|---|
| INCB-009471 | ChEMBL |
| INCB009471 | ChEMBL |
| Incb-9471 | ChEMBL |
| INCB9471 | ChEMBL |
| Citations |
|---|