EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N7O3S |
| Net Charge | 0 |
| Average Mass | 377.430 |
| Monoisotopic Mass | 377.12701 |
| SMILES | CS(=O)(=O)N1CCc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C15H19N7O3S/c1-26(23,24)22-3-2-11-12(10-8-17-14(16)18-9-10)19-15(20-13(11)22)21-4-6-25-7-5-21/h8-9H,2-7H2,1H3,(H2,16,17,18) |
| InChIKey | JEGHXKRHKHPBJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| izorlisib (CHEBI:749964) has role antineoplastic agent (CHEBI:35610) |
| izorlisib (CHEBI:749964) is a pyrrolopyrimidine (CHEBI:38670) |
| INN | Source |
|---|---|
| izorlisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ch 5132799 | ChEMBL |
| CH-5132799 | ChEMBL |
| CH5132799 | ChEMBL |
| CH5132799-000 | ChEMBL |
| PA-799 | ChEMBL |
| PA799 | ChEMBL |
| Citations |
|---|